C13H15ClFNO — CID 103052482
3-(azetidin-3-yl)-1-(5-chloro-2-fluorophenyl)butan-2-one (PubChem CID 103052482) has the molecular formula C13H15ClFNO and a molecular weight of 255.72 g/mol. Its IUPAC name is 3-(azetidin-3-yl)-1-(5-chloro-2-fluorophenyl)butan-2-one.
| Compound Name | 3-(azetidin-3-yl)-1-(5-chloro-2-fluorophenyl)butan-2-one |
|---|---|
| PubChem CID | 103052482 |
| Molecular Formula | C13H15ClFNO |
| Molecular Weight | 255.72 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 3-(azetidin-3-yl)-1-(5-chloro-2-fluorophenyl)butan-2-one |
| SMILES | CC(C(=O)Cc1cc(Cl)ccc1F)C1CNC1 |
| InChI | InChI=1S/C13H15ClFNO/c1-8(10-6-16-7-10)13(17)5-9-4-11(14)2-3-12(9)15/h2-4,8,10,16H,5-7H2,1H3 |
| InChIKey | KYUHCUYPMQMILH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.72 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |