C13H24N4S — CID 103056808
N-ethyl-5-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]pyrazin-2-amine (PubChem CID 103056808) has the molecular formula C13H24N4S and a molecular weight of 268.43 g/mol. Its IUPAC name is N-ethyl-5-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]pyrazin-2-amine.
| Compound Name | N-ethyl-5-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 103056808 |
| Molecular Formula | C13H24N4S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | N-ethyl-5-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]pyrazin-2-amine |
| SMILES | CCNc1cnc(CN(C)C(CC)CSC)cn1 |
| InChI | InChI=1S/C13H24N4S/c1-5-12(10-18-4)17(3)9-11-7-16-13(8-15-11)14-6-2/h7-8,12H,5-6,9-10H2,1-4H3,(H,14,16) |
| InChIKey | ZXJQUDJAEFUDPM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |