C13H14BrN3S — CID 103059893
5-[(4-bromophenyl)sulfanylmethyl]-N-ethylpyrazin-2-amine (PubChem CID 103059893) has the molecular formula C13H14BrN3S and a molecular weight of 324.25 g/mol. Its IUPAC name is 5-[(4-bromophenyl)sulfanylmethyl]-N-ethylpyrazin-2-amine.
| Compound Name | 5-[(4-bromophenyl)sulfanylmethyl]-N-ethylpyrazin-2-amine |
|---|---|
| PubChem CID | 103059893 |
| Molecular Formula | C13H14BrN3S |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 5-[(4-bromophenyl)sulfanylmethyl]-N-ethylpyrazin-2-amine |
| SMILES | CCNc1cnc(CSc2ccc(Br)cc2)cn1 |
| InChI | InChI=1S/C13H14BrN3S/c1-2-15-13-8-16-11(7-17-13)9-18-12-5-3-10(14)4-6-12/h3-8H,2,9H2,1H3,(H,15,17) |
| InChIKey | HEICNWZAVHKSBS-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |