C13H13F2N3S — CID 103059924
5-[(2,5-difluorophenyl)sulfanylmethyl]-N-ethylpyrazin-2-amine (PubChem CID 103059924) has the molecular formula C13H13F2N3S and a molecular weight of 281.33 g/mol. Its IUPAC name is 5-[(2,5-difluorophenyl)sulfanylmethyl]-N-ethylpyrazin-2-amine.
| Compound Name | 5-[(2,5-difluorophenyl)sulfanylmethyl]-N-ethylpyrazin-2-amine |
|---|---|
| PubChem CID | 103059924 |
| Molecular Formula | C13H13F2N3S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 5-[(2,5-difluorophenyl)sulfanylmethyl]-N-ethylpyrazin-2-amine |
| SMILES | CCNc1cnc(CSc2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C13H13F2N3S/c1-2-16-13-7-17-10(6-18-13)8-19-12-5-9(14)3-4-11(12)15/h3-7H,2,8H2,1H3,(H,16,18) |
| InChIKey | ZDLGDLNFYKQHSO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |