C14H14F2N4O — CID 107375724
N-[(2,5-difluorophenyl)methyl]-5-(ethylamino)pyrazine-2-carboxamide (PubChem CID 107375724) has the molecular formula C14H14F2N4O and a molecular weight of 292.29 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-5-(ethylamino)pyrazine-2-carboxamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-5-(ethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107375724 |
| Molecular Formula | C14H14F2N4O |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-5-(ethylamino)pyrazine-2-carboxamide |
| SMILES | CCNc1cnc(C(=O)NCc2cc(F)ccc2F)cn1 |
| InChI | InChI=1S/C14H14F2N4O/c1-2-17-13-8-18-12(7-19-13)14(21)20-6-9-5-10(15)3-4-11(9)16/h3-5,7-8H,2,6H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | HCPGVKYYKMAGPM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |