C14H12FN5O — CID 107376511
N-(2-cyano-4-fluorophenyl)-5-(ethylamino)pyrazine-2-carboxamide (PubChem CID 107376511) has the molecular formula C14H12FN5O and a molecular weight of 285.28 g/mol. Its IUPAC name is N-(2-cyano-4-fluorophenyl)-5-(ethylamino)pyrazine-2-carboxamide.
| Compound Name | N-(2-cyano-4-fluorophenyl)-5-(ethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 107376511 |
| Molecular Formula | C14H12FN5O |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | N-(2-cyano-4-fluorophenyl)-5-(ethylamino)pyrazine-2-carboxamide |
| SMILES | CCNc1cnc(C(=O)Nc2ccc(F)cc2C#N)cn1 |
| InChI | InChI=1S/C14H12FN5O/c1-2-17-13-8-18-12(7-19-13)14(21)20-11-4-3-10(15)5-9(11)6-16/h3-5,7-8H,2H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | VWLKJTRZXFVEMJ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |