C15H13FN4O — CID 105070921
N-(2-cyano-4-fluorophenyl)-3-(ethylamino)pyridine-4-carboxamide (PubChem CID 105070921) has the molecular formula C15H13FN4O and a molecular weight of 284.29 g/mol. Its IUPAC name is N-(2-cyano-4-fluorophenyl)-3-(ethylamino)pyridine-4-carboxamide.
| Compound Name | N-(2-cyano-4-fluorophenyl)-3-(ethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105070921 |
| Molecular Formula | C15H13FN4O |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-(2-cyano-4-fluorophenyl)-3-(ethylamino)pyridine-4-carboxamide |
| SMILES | CCNc1cnccc1C(=O)Nc1ccc(F)cc1C#N |
| InChI | InChI=1S/C15H13FN4O/c1-2-19-14-9-18-6-5-12(14)15(21)20-13-4-3-11(16)7-10(13)8-17/h3-7,9,19H,2H2,1H3,(H,20,21) |
| InChIKey | ZZNNCFJUMOVFRW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |