C14H13F2N3O — CID 105068357
N-(3,5-difluorophenyl)-3-(ethylamino)pyridine-4-carboxamide (PubChem CID 105068357) has the molecular formula C14H13F2N3O and a molecular weight of 277.27 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-3-(ethylamino)pyridine-4-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-3-(ethylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105068357 |
| Molecular Formula | C14H13F2N3O |
| Molecular Weight | 277.27 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | N-(3,5-difluorophenyl)-3-(ethylamino)pyridine-4-carboxamide |
| SMILES | CCNc1cnccc1C(=O)Nc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H13F2N3O/c1-2-18-13-8-17-4-3-12(13)14(20)19-11-6-9(15)5-10(16)7-11/h3-8,18H,2H2,1H3,(H,19,20) |
| InChIKey | GOOVWOHURKUBAY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |