C12H13N3OS — CID 105070563
3-(ethylamino)-N-thiophen-3-ylpyridine-4-carboxamide (PubChem CID 105070563) has the molecular formula C12H13N3OS and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-(ethylamino)-N-thiophen-3-ylpyridine-4-carboxamide.
| Compound Name | 3-(ethylamino)-N-thiophen-3-ylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 105070563 |
| Molecular Formula | C12H13N3OS |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 3-(ethylamino)-N-thiophen-3-ylpyridine-4-carboxamide |
| SMILES | CCNc1cnccc1C(=O)Nc1ccsc1 |
| InChI | InChI=1S/C12H13N3OS/c1-2-14-11-7-13-5-3-10(11)12(16)15-9-4-6-17-8-9/h3-8,14H,2H2,1H3,(H,15,16) |
| InChIKey | VGSKWXUREZUCCC-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |