C14H16N4OS — CID 103059780
N-[4-[[5-(methylamino)pyrazin-2-yl]methylsulfanyl]phenyl]acetamide (PubChem CID 103059780) has the molecular formula C14H16N4OS and a molecular weight of 288.38 g/mol. Its IUPAC name is N-[4-[[5-(methylamino)pyrazin-2-yl]methylsulfanyl]phenyl]acetamide.
| Compound Name | N-[4-[[5-(methylamino)pyrazin-2-yl]methylsulfanyl]phenyl]acetamide |
|---|---|
| PubChem CID | 103059780 |
| Molecular Formula | C14H16N4OS |
| Molecular Weight | 288.38 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | N-[4-[[5-(methylamino)pyrazin-2-yl]methylsulfanyl]phenyl]acetamide |
| SMILES | CNc1cnc(CSc2ccc(NC(C)=O)cc2)cn1 |
| InChI | InChI=1S/C14H16N4OS/c1-10(19)18-11-3-5-13(6-4-11)20-9-12-7-17-14(15-2)8-16-12/h3-8H,9H2,1-2H3,(H,15,17)(H,18,19) |
| InChIKey | NRQNWVZIRKFZAU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |