C12H17N5O2 — CID 103057285
1-[[5-(ethylamino)pyrazin-2-yl]methyl]-4-methylpiperazine-2,3-dione (PubChem CID 103057285) has the molecular formula C12H17N5O2 and a molecular weight of 263.30 g/mol. Its IUPAC name is 1-[[5-(ethylamino)pyrazin-2-yl]methyl]-4-methylpiperazine-2,3-dione.
| Compound Name | 1-[[5-(ethylamino)pyrazin-2-yl]methyl]-4-methylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 103057285 |
| Molecular Formula | C12H17N5O2 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 1-[[5-(ethylamino)pyrazin-2-yl]methyl]-4-methylpiperazine-2,3-dione |
| SMILES | CCNc1cnc(CN2CCN(C)C(=O)C2=O)cn1 |
| InChI | InChI=1S/C12H17N5O2/c1-3-13-10-7-14-9(6-15-10)8-17-5-4-16(2)11(18)12(17)19/h6-7H,3-5,8H2,1-2H3,(H,13,15) |
| InChIKey | NHWKENXNKHJHAC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|