C10H14N6O2 — CID 103061454
1-[(5-hydrazinylpyrazin-2-yl)methyl]-4-methylpiperazine-2,3-dione (PubChem CID 103061454) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is 1-[(5-hydrazinylpyrazin-2-yl)methyl]-4-methylpiperazine-2,3-dione.
| Compound Name | 1-[(5-hydrazinylpyrazin-2-yl)methyl]-4-methylpiperazine-2,3-dione |
|---|---|
| PubChem CID | 103061454 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | 1-[(5-hydrazinylpyrazin-2-yl)methyl]-4-methylpiperazine-2,3-dione |
| SMILES | CN1CCN(Cc2cnc(NN)cn2)C(=O)C1=O |
| InChI | InChI=1S/C10H14N6O2/c1-15-2-3-16(10(18)9(15)17)6-7-4-13-8(14-11)5-12-7/h4-5H,2-3,6,11H2,1H3,(H,13,14) |
| InChIKey | CBQLHYWIAJJQTL-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|