C8H10N6O2 — CID 103061297
3-[(5-hydrazinylpyrazin-2-yl)methyl]imidazolidine-2,4-dione (PubChem CID 103061297) has the molecular formula C8H10N6O2 and a molecular weight of 222.21 g/mol. Its IUPAC name is 3-[(5-hydrazinylpyrazin-2-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[(5-hydrazinylpyrazin-2-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 103061297 |
| Molecular Formula | C8H10N6O2 |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 3-[(5-hydrazinylpyrazin-2-yl)methyl]imidazolidine-2,4-dione |
| SMILES | NNc1cnc(CN2C(=O)CNC2=O)cn1 |
| InChI | InChI=1S/C8H10N6O2/c9-13-6-2-10-5(1-11-6)4-14-7(15)3-12-8(14)16/h1-2H,3-4,9H2,(H,11,13)(H,12,16) |
| InChIKey | MEUFUQPNQDYETH-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 113.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|