C11H17N7O — CID 103061081
7-[(5-hydrazinylpyrazin-2-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 103061081) has the molecular formula C11H17N7O and a molecular weight of 263.30 g/mol. Its IUPAC name is 7-[(5-hydrazinylpyrazin-2-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[(5-hydrazinylpyrazin-2-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 103061081 |
| Molecular Formula | C11H17N7O |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 7-[(5-hydrazinylpyrazin-2-yl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | NNc1cnc(CN2CCN3C(=O)NCC3C2)cn1 |
| InChI | InChI=1S/C11H17N7O/c12-16-10-5-13-8(3-14-10)6-17-1-2-18-9(7-17)4-15-11(18)19/h3,5,9H,1-2,4,6-7,12H2,(H,14,16)(H,15,19) |
| InChIKey | OXSMQDCWMDOPMH-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|