C12H16ClN5O — CID 79094056
7-[(6-amino-3-chloro-2-pyridinyl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79094056) has the molecular formula C12H16ClN5O and a molecular weight of 281.75 g/mol. Its IUPAC name is 7-[(6-amino-3-chloro-2-pyridinyl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[(6-amino-3-chloro-2-pyridinyl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79094056 |
| Molecular Formula | C12H16ClN5O |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 7-[(6-amino-3-chloro-2-pyridinyl)methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | Nc1ccc(Cl)c(CN2CCN3C(=O)NCC3C2)n1 |
| InChI | InChI=1S/C12H16ClN5O/c13-9-1-2-11(14)16-10(9)7-17-3-4-18-8(6-17)5-15-12(18)19/h1-2,8H,3-7H2,(H2,14,16)(H,15,19) |
| InChIKey | CMKVHCFUHIONCQ-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |