C15H19N3O3 — CID 105346095
2-[4-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]phenyl]acetic acid (PubChem CID 105346095) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-[4-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 105346095 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-[4-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]phenyl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CN2CCN3C(=O)NCC3C2)cc1 |
| InChI | InChI=1S/C15H19N3O3/c19-14(20)7-11-1-3-12(4-2-11)9-17-5-6-18-13(10-17)8-16-15(18)21/h1-4,13H,5-10H2,(H,16,21)(H,19,20) |
| InChIKey | WOLOTUPKDUQOCH-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |