C14H16N4O — CID 75368544
4-[[(8aS)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]methyl]benzonitrile (PubChem CID 75368544) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 4-[[(8aS)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]methyl]benzonitrile.
| Compound Name | 4-[[(8aS)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 75368544 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 4-[[(8aS)-3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CN2CCN3C(=O)NC[C@H]3C2)cc1 |
| InChI | InChI=1S/C14H16N4O/c15-7-11-1-3-12(4-2-11)9-17-5-6-18-13(10-17)8-16-14(18)19/h1-4,13H,5-6,8-10H2,(H,16,19)/t13-/m0/s1 |
| InChIKey | AIFRASUHXHCRKC-ZDUSSCGKSA-N |
| XLogP | 0.77 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |