C15H19N3 — CID 115313676
4-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)benzonitrile (PubChem CID 115313676) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is 4-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)benzonitrile.
| Compound Name | 4-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)benzonitrile |
|---|---|
| PubChem CID | 115313676 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | 4-(3,9-diazabicyclo[4.2.1]nonan-3-ylmethyl)benzonitrile |
| SMILES | N#Cc1ccc(CN2CCC3CCC(C2)N3)cc1 |
| InChI | InChI=1S/C15H19N3/c16-9-12-1-3-13(4-2-12)10-18-8-7-14-5-6-15(11-18)17-14/h1-4,14-15,17H,5-8,10-11H2 |
| InChIKey | VLMAUOCIHRTKKH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |