C14H18Cl2N2 — CID 81491207
3-[(3,4-dichlorophenyl)methyl]-3,9-diazabicyclo[4.2.1]nonane (PubChem CID 81491207) has the molecular formula C14H18Cl2N2 and a molecular weight of 285.22 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-3,9-diazabicyclo[4.2.1]nonane.
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-3,9-diazabicyclo[4.2.1]nonane |
|---|---|
| PubChem CID | 81491207 |
| Molecular Formula | C14H18Cl2N2 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-3,9-diazabicyclo[4.2.1]nonane |
| SMILES | Clc1ccc(CN2CCC3CCC(C2)N3)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2/c15-13-4-1-10(7-14(13)16)8-18-6-5-11-2-3-12(9-18)17-11/h1,4,7,11-12,17H,2-3,5-6,8-9H2 |
| InChIKey | MRAYCBKMKKRHBC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |