C15H18N4O2 — CID 79096075
2-methoxy-5-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]benzonitrile (PubChem CID 79096075) has the molecular formula C15H18N4O2 and a molecular weight of 286.34 g/mol. Its IUPAC name is 2-methoxy-5-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]benzonitrile.
| Compound Name | 2-methoxy-5-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 79096075 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-methoxy-5-[(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)methyl]benzonitrile |
| SMILES | COc1ccc(CN2CCN3C(=O)NCC3C2)cc1C#N |
| InChI | InChI=1S/C15H18N4O2/c1-21-14-3-2-11(6-12(14)7-16)9-18-4-5-19-13(10-18)8-17-15(19)20/h2-3,6,13H,4-5,8-10H2,1H3,(H,17,20) |
| InChIKey | ZQLRCZGFDZHSFE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 68.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |