C10H16N6O2 — CID 114218059
7-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 114218059) has the molecular formula C10H16N6O2 and a molecular weight of 252.28 g/mol. Its IUPAC name is 7-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 114218059 |
| Molecular Formula | C10H16N6O2 |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 7-[[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | NCc1nc(CN2CCN3C(=O)NCC3C2)no1 |
| InChI | InChI=1S/C10H16N6O2/c11-3-9-13-8(14-18-9)6-15-1-2-16-7(5-15)4-12-10(16)17/h7H,1-6,11H2,(H,12,17) |
| InChIKey | AUAAEEYKDXCTAX-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |