C12H18F3N3O — CID 103059360
N-propyl-5-(4,4,4-trifluorobutoxymethyl)pyrazin-2-amine (PubChem CID 103059360) has the molecular formula C12H18F3N3O and a molecular weight of 277.29 g/mol. Its IUPAC name is N-propyl-5-(4,4,4-trifluorobutoxymethyl)pyrazin-2-amine.
| Compound Name | N-propyl-5-(4,4,4-trifluorobutoxymethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 103059360 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-propyl-5-(4,4,4-trifluorobutoxymethyl)pyrazin-2-amine |
| SMILES | CCCNc1cnc(COCCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C12H18F3N3O/c1-2-5-16-11-8-17-10(7-18-11)9-19-6-3-4-12(13,14)15/h7-8H,2-6,9H2,1H3,(H,16,18) |
| InChIKey | PGUONMXIWMBVRY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|