C10H17N5O2S2 — CID 103061077
[5-[(3-methylsulfonylthiomorpholin-4-yl)methyl]pyrazin-2-yl]hydrazine (PubChem CID 103061077) has the molecular formula C10H17N5O2S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is [5-[(3-methylsulfonylthiomorpholin-4-yl)methyl]pyrazin-2-yl]hydrazine.
| Compound Name | [5-[(3-methylsulfonylthiomorpholin-4-yl)methyl]pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103061077 |
| Molecular Formula | C10H17N5O2S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | [5-[(3-methylsulfonylthiomorpholin-4-yl)methyl]pyrazin-2-yl]hydrazine |
| SMILES | CS(=O)(=O)C1CSCCN1Cc1cnc(NN)cn1 |
| InChI | InChI=1S/C10H17N5O2S2/c1-19(16,17)10-7-18-3-2-15(10)6-8-4-13-9(14-11)5-12-8/h4-5,10H,2-3,6-7,11H2,1H3,(H,13,14) |
| InChIKey | HIELVURXJVELKZ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|