C12H20N4O2 — CID 103061982
[5-[(2,6-dimethyloxan-4-yl)oxymethyl]pyrazin-2-yl]hydrazine (PubChem CID 103061982) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is [5-[(2,6-dimethyloxan-4-yl)oxymethyl]pyrazin-2-yl]hydrazine.
| Compound Name | [5-[(2,6-dimethyloxan-4-yl)oxymethyl]pyrazin-2-yl]hydrazine |
|---|---|
| PubChem CID | 103061982 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | [5-[(2,6-dimethyloxan-4-yl)oxymethyl]pyrazin-2-yl]hydrazine |
| SMILES | CC1CC(OCc2cnc(NN)cn2)CC(C)O1 |
| InChI | InChI=1S/C12H20N4O2/c1-8-3-11(4-9(2)18-8)17-7-10-5-15-12(16-13)6-14-10/h5-6,8-9,11H,3-4,7,13H2,1-2H3,(H,15,16) |
| InChIKey | UQRGWNACWGCEFR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|