C11H20N2OS — CID 103065473
2,5-diethyl-3-(thiolan-3-yl)imidazolidin-4-one (PubChem CID 103065473) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 2,5-diethyl-3-(thiolan-3-yl)imidazolidin-4-one.
| Compound Name | 2,5-diethyl-3-(thiolan-3-yl)imidazolidin-4-one |
|---|---|
| PubChem CID | 103065473 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 2,5-diethyl-3-(thiolan-3-yl)imidazolidin-4-one |
| SMILES | CCC1NC(CC)N(C2CCSC2)C1=O |
| InChI | InChI=1S/C11H20N2OS/c1-3-9-11(14)13(10(4-2)12-9)8-5-6-15-7-8/h8-10,12H,3-7H2,1-2H3 |
| InChIKey | QYMFCWOOJFEWFN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |