C14H20N2OS2 — CID 103065521
5-ethyl-2-(5-methylthiophen-2-yl)-3-(thiolan-3-yl)imidazolidin-4-one (PubChem CID 103065521) has the molecular formula C14H20N2OS2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 5-ethyl-2-(5-methylthiophen-2-yl)-3-(thiolan-3-yl)imidazolidin-4-one.
| Compound Name | 5-ethyl-2-(5-methylthiophen-2-yl)-3-(thiolan-3-yl)imidazolidin-4-one |
|---|---|
| PubChem CID | 103065521 |
| Molecular Formula | C14H20N2OS2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 5-ethyl-2-(5-methylthiophen-2-yl)-3-(thiolan-3-yl)imidazolidin-4-one |
| SMILES | CCC1NC(c2ccc(C)s2)N(C2CCSC2)C1=O |
| InChI | InChI=1S/C14H20N2OS2/c1-3-11-14(17)16(10-6-7-18-8-10)13(15-11)12-5-4-9(2)19-12/h4-5,10-11,13,15H,3,6-8H2,1-2H3 |
| InChIKey | ZNFRFCZMCQESFM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |