C14H24ClNO — CID 103065801
5-tert-butyl-1-[2-(chloromethyl)prop-2-enyl]azepan-2-one (PubChem CID 103065801) has the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. Its IUPAC name is 5-tert-butyl-1-[2-(chloromethyl)prop-2-enyl]azepan-2-one.
| Compound Name | 5-tert-butyl-1-[2-(chloromethyl)prop-2-enyl]azepan-2-one |
|---|---|
| PubChem CID | 103065801 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.80 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 5-tert-butyl-1-[2-(chloromethyl)prop-2-enyl]azepan-2-one |
| SMILES | C=C(CCl)CN1CCC(C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C14H24ClNO/c1-11(9-15)10-16-8-7-12(14(2,3)4)5-6-13(16)17/h12H,1,5-10H2,2-4H3 |
| InChIKey | ZRYQBQOGVULVSY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.80 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|