C44H79N9O — CID 91250409
5-tert-butyl-1-ethylazepan-2-one;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane (PubChem CID 91250409) has the molecular formula C44H79N9O and a molecular weight of 750.18 g/mol. Its IUPAC name is 5-tert-butyl-1-ethylazepan-2-one;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane.
| Compound Name | 5-tert-butyl-1-ethylazepan-2-one;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
|---|---|
| PubChem CID | 91250409 |
| Molecular Formula | C44H79N9O |
| Molecular Weight | 750.18 g/mol |
| Exact Mass | 749.64 |
| IUPAC Name | 5-tert-butyl-1-ethylazepan-2-one;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane |
| SMILES | C1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C2C1.CCN1CCC(C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C32H56N8.C12H23NO/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;1-5-13-9-8-10(12(2,3)4)6-7-11(13)14/h17-40H,1-16H2;10H,5-9H2,1-4H3 |
| InChIKey | NQTJRUUCADFKED-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 116.55 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.18 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |