C10H11Cl2NO — CID 103066836
2-[(2,3-dichlorophenoxy)methyl]prop-2-en-1-amine (PubChem CID 103066836) has the molecular formula C10H11Cl2NO and a molecular weight of 232.11 g/mol. Its IUPAC name is 2-[(2,3-dichlorophenoxy)methyl]prop-2-en-1-amine.
| Compound Name | 2-[(2,3-dichlorophenoxy)methyl]prop-2-en-1-amine |
|---|---|
| PubChem CID | 103066836 |
| Molecular Formula | C10H11Cl2NO |
| Molecular Weight | 232.11 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-[(2,3-dichlorophenoxy)methyl]prop-2-en-1-amine |
| SMILES | C=C(CN)COc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H11Cl2NO/c1-7(5-13)6-14-9-4-2-3-8(11)10(9)12/h2-4H,1,5-6,13H2 |
| InChIKey | UZHUZDWYEJMVBQ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.11 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|