C14H17Br2NO2 — CID 103067342
N-[2-[(2,5-dibromo-4-methoxyphenoxy)methyl]prop-2-enyl]cyclopropanamine (PubChem CID 103067342) has the molecular formula C14H17Br2NO2 and a molecular weight of 391.10 g/mol. Its IUPAC name is N-[2-[(2,5-dibromo-4-methoxyphenoxy)methyl]prop-2-enyl]cyclopropanamine.
| Compound Name | N-[2-[(2,5-dibromo-4-methoxyphenoxy)methyl]prop-2-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 103067342 |
| Molecular Formula | C14H17Br2NO2 |
| Molecular Weight | 391.10 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | N-[2-[(2,5-dibromo-4-methoxyphenoxy)methyl]prop-2-enyl]cyclopropanamine |
| SMILES | C=C(CNC1CC1)COc1cc(Br)c(OC)cc1Br |
| InChI | InChI=1S/C14H17Br2NO2/c1-9(7-17-10-3-4-10)8-19-14-6-11(15)13(18-2)5-12(14)16/h5-6,10,17H,1,3-4,7-8H2,2H3 |
| InChIKey | PWANLTBNDHGMIC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.10 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|