C9H16ClNO2S — CID 103067995
4-[2-(chloromethyl)prop-2-enyl]-3-methyl-1,4-thiazinane 1,1-dioxide (PubChem CID 103067995) has the molecular formula C9H16ClNO2S and a molecular weight of 237.75 g/mol. Its IUPAC name is 4-[2-(chloromethyl)prop-2-enyl]-3-methyl-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[2-(chloromethyl)prop-2-enyl]-3-methyl-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 103067995 |
| Molecular Formula | C9H16ClNO2S |
| Molecular Weight | 237.75 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 4-[2-(chloromethyl)prop-2-enyl]-3-methyl-1,4-thiazinane 1,1-dioxide |
| SMILES | C=C(CCl)CN1CCS(=O)(=O)CC1C |
| InChI | InChI=1S/C9H16ClNO2S/c1-8(5-10)6-11-3-4-14(12,13)7-9(11)2/h9H,1,3-7H2,2H3 |
| InChIKey | RPXAZRAYMJGUBR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.75 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|