C8H14ClNOS — CID 103067732
4-[2-(chloromethyl)prop-2-enyl]-1,4-thiazinane 1-oxide (PubChem CID 103067732) has the molecular formula C8H14ClNOS and a molecular weight of 207.73 g/mol. Its IUPAC name is 4-[2-(chloromethyl)prop-2-enyl]-1,4-thiazinane 1-oxide.
| Compound Name | 4-[2-(chloromethyl)prop-2-enyl]-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 103067732 |
| Molecular Formula | C8H14ClNOS |
| Molecular Weight | 207.73 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 4-[2-(chloromethyl)prop-2-enyl]-1,4-thiazinane 1-oxide |
| SMILES | C=C(CCl)CN1CCS(=O)CC1 |
| InChI | InChI=1S/C8H14ClNOS/c1-8(6-9)7-10-2-4-12(11)5-3-10/h1-7H2 |
| InChIKey | FATCFHFVVFYIQW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.73 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|