C10H18ClNS — CID 103067877
4-[2-(chloromethyl)prop-2-enyl]-2,6-dimethylthiomorpholine (PubChem CID 103067877) has the molecular formula C10H18ClNS and a molecular weight of 219.78 g/mol. Its IUPAC name is 4-[2-(chloromethyl)prop-2-enyl]-2,6-dimethylthiomorpholine.
| Compound Name | 4-[2-(chloromethyl)prop-2-enyl]-2,6-dimethylthiomorpholine |
|---|---|
| PubChem CID | 103067877 |
| Molecular Formula | C10H18ClNS |
| Molecular Weight | 219.78 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 4-[2-(chloromethyl)prop-2-enyl]-2,6-dimethylthiomorpholine |
| SMILES | C=C(CCl)CN1CC(C)SC(C)C1 |
| InChI | InChI=1S/C10H18ClNS/c1-8(4-11)5-12-6-9(2)13-10(3)7-12/h9-10H,1,4-7H2,2-3H3 |
| InChIKey | VCZQFXDNCXYSIW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.78 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|