C10H20ClNS — CID 103066320
2-[2-(chloromethyl)prop-2-enylsulfanyl]-N,N-diethylethanamine (PubChem CID 103066320) has the molecular formula C10H20ClNS and a molecular weight of 221.80 g/mol. Its IUPAC name is 2-[2-(chloromethyl)prop-2-enylsulfanyl]-N,N-diethylethanamine.
| Compound Name | 2-[2-(chloromethyl)prop-2-enylsulfanyl]-N,N-diethylethanamine |
|---|---|
| PubChem CID | 103066320 |
| Molecular Formula | C10H20ClNS |
| Molecular Weight | 221.80 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 2-[2-(chloromethyl)prop-2-enylsulfanyl]-N,N-diethylethanamine |
| SMILES | C=C(CCl)CSCCN(CC)CC |
| InChI | InChI=1S/C10H20ClNS/c1-4-12(5-2)6-7-13-9-10(3)8-11/h3-9H2,1-2H3 |
| InChIKey | GIODVJMKKMRIRI-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.80 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|