C8H16ClNS — CID 103066325
2-[2-(chloromethyl)prop-2-enylsulfanyl]-N,N-dimethylethanamine (PubChem CID 103066325) has the molecular formula C8H16ClNS and a molecular weight of 193.74 g/mol. Its IUPAC name is 2-[2-(chloromethyl)prop-2-enylsulfanyl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(chloromethyl)prop-2-enylsulfanyl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 103066325 |
| Molecular Formula | C8H16ClNS |
| Molecular Weight | 193.74 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 2-[2-(chloromethyl)prop-2-enylsulfanyl]-N,N-dimethylethanamine |
| SMILES | C=C(CCl)CSCCN(C)C |
| InChI | InChI=1S/C8H16ClNS/c1-8(6-9)7-11-5-4-10(2)3/h1,4-7H2,2-3H3 |
| InChIKey | DDZMRJRWTOGKIP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.74 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|