C8H17NS — CID 123873898
N,N-dimethyl-2-(2-methylprop-2-enylsulfanyl)ethanamine (PubChem CID 123873898) has the molecular formula C8H17NS and a molecular weight of 159.30 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-methylprop-2-enylsulfanyl)ethanamine.
| Compound Name | N,N-dimethyl-2-(2-methylprop-2-enylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 123873898 |
| Molecular Formula | C8H17NS |
| Molecular Weight | 159.30 g/mol |
| Exact Mass | 159.11 |
| IUPAC Name | N,N-dimethyl-2-(2-methylprop-2-enylsulfanyl)ethanamine |
| SMILES | C=C(C)CSCCN(C)C |
| InChI | InChI=1S/C8H17NS/c1-8(2)7-10-6-5-9(3)4/h1,5-7H2,2-4H3 |
| InChIKey | KNWNNACOBMKMAJ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|