C9H20ClNS — CID 14914971
2-(3-chloropropylsulfanyl)-N,N-diethylethanamine (PubChem CID 14914971) has the molecular formula C9H20ClNS and a molecular weight of 209.79 g/mol. Its IUPAC name is 2-(3-chloropropylsulfanyl)-N,N-diethylethanamine.
| Compound Name | 2-(3-chloropropylsulfanyl)-N,N-diethylethanamine |
|---|---|
| PubChem CID | 14914971 |
| Molecular Formula | C9H20ClNS |
| Molecular Weight | 209.79 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 2-(3-chloropropylsulfanyl)-N,N-diethylethanamine |
| SMILES | CCN(CC)CCSCCCCl |
| InChI | InChI=1S/C9H20ClNS/c1-3-11(4-2)7-9-12-8-5-6-10/h3-9H2,1-2H3 |
| InChIKey | MMQTYMKDQVSYQZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.79 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|