C9H16ClNS — CID 103067697
4-[2-(chloromethyl)prop-2-enyl]-1,4-thiazepane (PubChem CID 103067697) has the molecular formula C9H16ClNS and a molecular weight of 205.75 g/mol. Its IUPAC name is 4-[2-(chloromethyl)prop-2-enyl]-1,4-thiazepane.
| Compound Name | 4-[2-(chloromethyl)prop-2-enyl]-1,4-thiazepane |
|---|---|
| PubChem CID | 103067697 |
| Molecular Formula | C9H16ClNS |
| Molecular Weight | 205.75 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 4-[2-(chloromethyl)prop-2-enyl]-1,4-thiazepane |
| SMILES | C=C(CCl)CN1CCCSCC1 |
| InChI | InChI=1S/C9H16ClNS/c1-9(7-10)8-11-3-2-5-12-6-4-11/h1-8H2 |
| InChIKey | ABSIUYVKYNVUIV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.75 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|