C17H24FN3 — CID 103068745
N-[2-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]prop-2-enyl]cyclopropanamine (PubChem CID 103068745) has the molecular formula C17H24FN3 and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[2-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]prop-2-enyl]cyclopropanamine.
| Compound Name | N-[2-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]prop-2-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 103068745 |
| Molecular Formula | C17H24FN3 |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-[2-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]prop-2-enyl]cyclopropanamine |
| SMILES | C=C(CNC1CC1)CN1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H24FN3/c1-14(12-19-15-6-7-15)13-20-8-10-21(11-9-20)17-5-3-2-4-16(17)18/h2-5,15,19H,1,6-13H2 |
| InChIKey | GUZFUZPKDOZVAA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|