C13H19BrN2 — CID 103069628
N-[(2-bromophenyl)methyl]-N,N'-dimethyl-2-methylidenepropane-1,3-diamine (PubChem CID 103069628) has the molecular formula C13H19BrN2 and a molecular weight of 283.21 g/mol. Its IUPAC name is N-[(2-bromophenyl)methyl]-N,N'-dimethyl-2-methylidenepropane-1,3-diamine.
| Compound Name | N-[(2-bromophenyl)methyl]-N,N'-dimethyl-2-methylidenepropane-1,3-diamine |
|---|---|
| PubChem CID | 103069628 |
| Molecular Formula | C13H19BrN2 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | N-[(2-bromophenyl)methyl]-N,N'-dimethyl-2-methylidenepropane-1,3-diamine |
| SMILES | C=C(CNC)CN(C)Cc1ccccc1Br |
| InChI | InChI=1S/C13H19BrN2/c1-11(8-15-2)9-16(3)10-12-6-4-5-7-13(12)14/h4-7,15H,1,8-10H2,2-3H3 |
| InChIKey | ZPHQEMFNXWSBMA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|