C13H28N2O2 — CID 103069654
N,N-bis(2-methoxyethyl)-2-methylidene-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 103069654) has the molecular formula C13H28N2O2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)-2-methylidene-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N,N-bis(2-methoxyethyl)-2-methylidene-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103069654 |
| Molecular Formula | C13H28N2O2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | N,N-bis(2-methoxyethyl)-2-methylidene-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | C=C(CNC(C)C)CN(CCOC)CCOC |
| InChI | InChI=1S/C13H28N2O2/c1-12(2)14-10-13(3)11-15(6-8-16-4)7-9-17-5/h12,14H,3,6-11H2,1-2,4-5H3 |
| InChIKey | QIGXVQIWBJZLID-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|