C14H28N2 — CID 103069805
N-butyl-N-cyclopropyl-2-methylidene-N'-propan-2-ylpropane-1,3-diamine (PubChem CID 103069805) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is N-butyl-N-cyclopropyl-2-methylidene-N'-propan-2-ylpropane-1,3-diamine.
| Compound Name | N-butyl-N-cyclopropyl-2-methylidene-N'-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103069805 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | N-butyl-N-cyclopropyl-2-methylidene-N'-propan-2-ylpropane-1,3-diamine |
| SMILES | C=C(CNC(C)C)CN(CCCC)C1CC1 |
| InChI | InChI=1S/C14H28N2/c1-5-6-9-16(14-7-8-14)11-13(4)10-15-12(2)3/h12,14-15H,4-11H2,1-3H3 |
| InChIKey | PYEYJEFUWBUYRZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|