C11H22N2 — CID 103069258
N-cyclopropyl-N,N'-diethyl-2-methylidenepropane-1,3-diamine (PubChem CID 103069258) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is N-cyclopropyl-N,N'-diethyl-2-methylidenepropane-1,3-diamine.
| Compound Name | N-cyclopropyl-N,N'-diethyl-2-methylidenepropane-1,3-diamine |
|---|---|
| PubChem CID | 103069258 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N-cyclopropyl-N,N'-diethyl-2-methylidenepropane-1,3-diamine |
| SMILES | C=C(CNCC)CN(CC)C1CC1 |
| InChI | InChI=1S/C11H22N2/c1-4-12-8-10(3)9-13(5-2)11-6-7-11/h11-12H,3-9H2,1-2H3 |
| InChIKey | RVVVPJGMKCXZOW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|