C11H25N3 — CID 103070658
N-[2-(dimethylamino)ethyl]-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine (PubChem CID 103070658) has the molecular formula C11H25N3 and a molecular weight of 199.34 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine.
| Compound Name | N-[2-(dimethylamino)ethyl]-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine |
|---|---|
| PubChem CID | 103070658 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-N'-ethyl-N-methyl-2-methylidenepropane-1,3-diamine |
| SMILES | C=C(CNCC)CN(C)CCN(C)C |
| InChI | InChI=1S/C11H25N3/c1-6-12-9-11(2)10-14(5)8-7-13(3)4/h12H,2,6-10H2,1,3-5H3 |
| InChIKey | BWIDGZBQTSDXAU-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|