C15H28N2 — CID 103070072
N-cyclopropyl-N'-methyl-N'-(2-methylcyclohexyl)-2-methylidenepropane-1,3-diamine (PubChem CID 103070072) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is N-cyclopropyl-N'-methyl-N'-(2-methylcyclohexyl)-2-methylidenepropane-1,3-diamine.
| Compound Name | N-cyclopropyl-N'-methyl-N'-(2-methylcyclohexyl)-2-methylidenepropane-1,3-diamine |
|---|---|
| PubChem CID | 103070072 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N-cyclopropyl-N'-methyl-N'-(2-methylcyclohexyl)-2-methylidenepropane-1,3-diamine |
| SMILES | C=C(CNC1CC1)CN(C)C1CCCCC1C |
| InChI | InChI=1S/C15H28N2/c1-12(10-16-14-8-9-14)11-17(3)15-7-5-4-6-13(15)2/h13-16H,1,4-11H2,2-3H3 |
| InChIKey | XAAWFDFMJRTZFW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|