C14H22N2S — CID 103069890
N-cyclopropyl-N'-methyl-2-methylidene-N'-(1-thiophen-2-ylethyl)propane-1,3-diamine (PubChem CID 103069890) has the molecular formula C14H22N2S and a molecular weight of 250.41 g/mol. Its IUPAC name is N-cyclopropyl-N'-methyl-2-methylidene-N'-(1-thiophen-2-ylethyl)propane-1,3-diamine.
| Compound Name | N-cyclopropyl-N'-methyl-2-methylidene-N'-(1-thiophen-2-ylethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 103069890 |
| Molecular Formula | C14H22N2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | N-cyclopropyl-N'-methyl-2-methylidene-N'-(1-thiophen-2-ylethyl)propane-1,3-diamine |
| SMILES | C=C(CNC1CC1)CN(C)C(C)c1cccs1 |
| InChI | InChI=1S/C14H22N2S/c1-11(9-15-13-6-7-13)10-16(3)12(2)14-5-4-8-17-14/h4-5,8,12-13,15H,1,6-7,9-10H2,2-3H3 |
| InChIKey | VDMGRBKAHXGREM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|