C16H20ClN3S — CID 114925792
5-chloro-4-[(cyclopropylamino)methyl]-N-methyl-N-(1-thiophen-2-ylethyl)pyridin-2-amine (PubChem CID 114925792) has the molecular formula C16H20ClN3S and a molecular weight of 321.88 g/mol. Its IUPAC name is 5-chloro-4-[(cyclopropylamino)methyl]-N-methyl-N-(1-thiophen-2-ylethyl)pyridin-2-amine.
| Compound Name | 5-chloro-4-[(cyclopropylamino)methyl]-N-methyl-N-(1-thiophen-2-ylethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 114925792 |
| Molecular Formula | C16H20ClN3S |
| Molecular Weight | 321.88 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 5-chloro-4-[(cyclopropylamino)methyl]-N-methyl-N-(1-thiophen-2-ylethyl)pyridin-2-amine |
| SMILES | CC(c1cccs1)N(C)c1cc(CNC2CC2)c(Cl)cn1 |
| InChI | InChI=1S/C16H20ClN3S/c1-11(15-4-3-7-21-15)20(2)16-8-12(14(17)10-19-16)9-18-13-5-6-13/h3-4,7-8,10-11,13,18H,5-6,9H2,1-2H3 |
| InChIKey | MKJSOZJOBDMKQU-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.88 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |