C16H17ClFN3 — CID 114926024
5-chloro-4-[(cyclopropylamino)methyl]-N-(3-fluorophenyl)-N-methylpyridin-2-amine (PubChem CID 114926024) has the molecular formula C16H17ClFN3 and a molecular weight of 305.78 g/mol. Its IUPAC name is 5-chloro-4-[(cyclopropylamino)methyl]-N-(3-fluorophenyl)-N-methylpyridin-2-amine.
| Compound Name | 5-chloro-4-[(cyclopropylamino)methyl]-N-(3-fluorophenyl)-N-methylpyridin-2-amine |
|---|---|
| PubChem CID | 114926024 |
| Molecular Formula | C16H17ClFN3 |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 5-chloro-4-[(cyclopropylamino)methyl]-N-(3-fluorophenyl)-N-methylpyridin-2-amine |
| SMILES | CN(c1cccc(F)c1)c1cc(CNC2CC2)c(Cl)cn1 |
| InChI | InChI=1S/C16H17ClFN3/c1-21(14-4-2-3-12(18)8-14)16-7-11(15(17)10-20-16)9-19-13-5-6-13/h2-4,7-8,10,13,19H,5-6,9H2,1H3 |
| InChIKey | UUANGGPJYFDATJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |