C11H15NS2 — CID 103068085
N-[2-(thiophen-2-ylsulfanylmethyl)prop-2-enyl]cyclopropanamine (PubChem CID 103068085) has the molecular formula C11H15NS2 and a molecular weight of 225.38 g/mol. Its IUPAC name is N-[2-(thiophen-2-ylsulfanylmethyl)prop-2-enyl]cyclopropanamine.
| Compound Name | N-[2-(thiophen-2-ylsulfanylmethyl)prop-2-enyl]cyclopropanamine |
|---|---|
| PubChem CID | 103068085 |
| Molecular Formula | C11H15NS2 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | N-[2-(thiophen-2-ylsulfanylmethyl)prop-2-enyl]cyclopropanamine |
| SMILES | C=C(CNC1CC1)CSc1cccs1 |
| InChI | InChI=1S/C11H15NS2/c1-9(7-12-10-4-5-10)8-14-11-3-2-6-13-11/h2-3,6,10,12H,1,4-5,7-8H2 |
| InChIKey | FRXSHPRNQKDLMZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|