C11H15NO2S2 — CID 43427796
1-(4-hydroxypiperidin-1-yl)-2-thiophen-2-ylsulfanylethanone (PubChem CID 43427796) has the molecular formula C11H15NO2S2 and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-(4-hydroxypiperidin-1-yl)-2-thiophen-2-ylsulfanylethanone.
| Compound Name | 1-(4-hydroxypiperidin-1-yl)-2-thiophen-2-ylsulfanylethanone |
|---|---|
| PubChem CID | 43427796 |
| Molecular Formula | C11H15NO2S2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 1-(4-hydroxypiperidin-1-yl)-2-thiophen-2-ylsulfanylethanone |
| SMILES | O=C(CSc1cccs1)N1CCC(O)CC1 |
| InChI | InChI=1S/C11H15NO2S2/c13-9-3-5-12(6-4-9)10(14)8-16-11-2-1-7-15-11/h1-2,7,9,13H,3-6,8H2 |
| InChIKey | BIGCOOLGBVAXOA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |